EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H49O7P2 |
| Net Charge | -3 |
| Average Mass | 583.663 |
| Monoisotopic Mass | 583.29700 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/[C@H]1[C@H](COP(=O)([O-])OP(=O)([O-])[O-])[C@@]1(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H52O7P2/c1-23(2)13-9-15-25(5)17-11-18-27(7)21-28-29(22-36-39(34,35)37-38(31,32)33)30(28,8)20-12-19-26(6)16-10-14-24(3)4/h13-14,17,19,21,28-29H,9-12,15-16,18,20,22H2,1-8H3,(H,34,35)(H2,31,32,33)/p-3/b25-17+,26-19+,27-21+/t28-,29-,30-/m0/s1 |
| InChIKey | ATZKAUGGNMSCCY-VYCBRMPGSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| presqualene diphosphate(3−) (CHEBI:57310) has role human metabolite (CHEBI:77746) |
| presqualene diphosphate(3−) (CHEBI:57310) is a organophosphate oxoanion (CHEBI:58945) |
| presqualene diphosphate(3−) (CHEBI:57310) is conjugate base of presqualene diphosphate (CHEBI:15442) |
| Incoming Relation(s) |
| presqualene diphosphate (CHEBI:15442) is conjugate acid of presqualene diphosphate(3−) (CHEBI:57310) |
| IUPAC Name |
|---|
| {(1R,2R,3R)-2-[(3E)-4,8-dimethylnona-3,7-dien-1-yl]-2-methyl-3-[(2E,6E)-2,6,10-trimethylundeca-1,5,9-trien-1-yl]cyclopropan-1-yl}methyl diphosphate |
| UniProt Name | Source |
|---|---|
| presqualene diphosphate | UniProt |