EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | O=C1/C(=C/c2ccc(O)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)7-14-15(18)12-6-5-11(17)8-13(12)19-14/h1-8,16-17H/b14-7- |
| InChIKey | KEZLDSPIRVZOKZ-AUWJEWJLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hispidol (CHEBI:5731) has functional parent aurone (CHEBI:47964) |
| hispidol (CHEBI:5731) has role plant metabolite (CHEBI:76924) |
| hispidol (CHEBI:5731) is a hydroxyaurone (CHEBI:85970) |
| IUPAC Name |
|---|
| (2Z)-6-hydroxy-2-[(4-hydroxyphenyl)methylidene]-1-benzofuran-3(2H)-one |
| Citations |
|---|