EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O4 |
| Net Charge | 0 |
| Average Mass | 392.495 |
| Monoisotopic Mass | 392.19876 |
| SMILES | CC(C)=CCc1c(O)ccc([C@@H]2COc3c(ccc4c3C=CC(C)(C)O4)C2)c1O |
| InChI | InChI=1S/C25H28O4/c1-15(2)5-7-19-21(26)9-8-18(23(19)27)17-13-16-6-10-22-20(24(16)28-14-17)11-12-25(3,4)29-22/h5-6,8-12,17,26-27H,7,13-14H2,1-4H3/t17-/m0/s1 |
| InChIKey | HZHXMXSXYQCAIG-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza glabra (ncbitaxon:49827) | - | PubMed (7381508) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hispaglabridin A (CHEBI:5730) has parent hydride (R)-isoflavan (CHEBI:36101) |
| hispaglabridin A (CHEBI:5730) has role plant metabolite (CHEBI:76924) |
| hispaglabridin A (CHEBI:5730) is a hydroxyisoflavans (CHEBI:76250) |
| IUPAC Name |
|---|
| 4-[(3R)-8,8-dimethyl-3,4-dihydro-2H,8H-benzo[1,2-b:3,4-b']dipyran-3-yl]-2-(3-methylbut-2-en-1-yl)benzene-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| C00002534 | KNApSAcK |
| C10425 | KEGG COMPOUND |
| HMDB0038102 | HMDB |
| LMPK12080013 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7495534 | Reaxys |
| CAS:68978-03-0 | KEGG COMPOUND |
| Citations |
|---|