EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16NO |
| Net Charge | +1 |
| Average Mass | 166.244 |
| Monoisotopic Mass | 166.12264 |
| SMILES | C[NH2+][C@@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/p+1/t8-,10-/m0/s1 |
| InChIKey | KWGRBVOPPLSCSI-WPRPVWTQSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-ephedrinium (CHEBI:57295) is a ammonium ion derivative (CHEBI:35274) |
| (−)-ephedrinium (CHEBI:57295) is conjugate acid of (−)-ephedrine (CHEBI:15407) |
| (−)-ephedrinium (CHEBI:57295) is enantiomer of (1S,2R)-ephedrine(1+) (CHEBI:149673) |
| Incoming Relation(s) |
| (−)-ephedrine (CHEBI:15407) is conjugate base of (−)-ephedrinium (CHEBI:57295) |
| (1S,2R)-ephedrine(1+) (CHEBI:149673) is enantiomer of (−)-ephedrinium (CHEBI:57295) |
| IUPAC Name |
|---|
| (1R,2S)-1-hydroxy-N-methyl-1-phenylpropan-2-aminium |
| UniProt Name | Source |
|---|---|
| (1R,2S)-ephedrine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2740959 | Gmelin |
| Beilstein:4921787 | Beilstein |