EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27N8O5 |
| Net Charge | +1 |
| Average Mass | 423.454 |
| Monoisotopic Mass | 423.20989 |
| SMILES | [H][C@]1(n2ccc(N)nc2=O)C=C[C@H](NC(=O)C[C@@H]([NH3+])CCN(C)C(N)=[NH2+])[C@@]([H])(C(=O)[O-])O1 |
| InChI | InChI=1S/C17H26N8O5/c1-24(16(20)21)6-4-9(18)8-12(26)22-10-2-3-13(30-14(10)15(27)28)25-7-5-11(19)23-17(25)29/h2-3,5,7,9-10,13-14H,4,6,8,18H2,1H3,(H3,20,21)(H,22,26)(H,27,28)(H2,19,23,29)/p+1/t9-,10-,13+,14-/m0/s1 |
| InChIKey | CXNPLSGKWMLZPZ-ZNIXKSQXSA-O |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| blasticidin S(1+) (CHEBI:57289) is a antibiotic antifungal agent (CHEBI:86478) |
| blasticidin S(1+) (CHEBI:57289) is a guanidinium ion (CHEBI:60251) |
| blasticidin S(1+) (CHEBI:57289) is conjugate acid of blasticidin S (CHEBI:15353) |
| Incoming Relation(s) |
| blasticidin S (CHEBI:15353) is conjugate base of blasticidin S(1+) (CHEBI:57289) |
| IUPAC Name |
|---|
| 4-amino-1-(4-{[(3S)-3-ammonio-5-{[ammonio(imino)methyl](methyl)amino}pentanoyl]amino}-2,3,4-trideoxy-beta-D-erythro-hex-2-enopyranosyluronosyl)pyrimidin-2(1H)-one |
| UniProt Name | Source |
|---|---|
| blasticidin S | UniProt |
| Manual Xrefs | Databases |
|---|---|
| BLASTICIDIN-S | MetaCyc |