EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17O7 |
| Net Charge | +1 |
| Average Mass | 345.327 |
| Monoisotopic Mass | 345.09688 |
| SMILES | COc1cc(O)c2cc(O)c(-c3cc(OC)c(O)c(OC)c3)[o+]c2c1 |
| InChI | InChI=1S/C18H16O7/c1-22-10-6-12(19)11-8-13(20)18(25-14(11)7-10)9-4-15(23-2)17(21)16(5-9)24-3/h4-8H,1-3H3,(H2-,19,20,21)/p+1 |
| InChIKey | JGPCLGHKWGCWNO-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Catharanthus roseus (ncbitaxon:4058) | - | PubMed (12628396) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hirsutidin (CHEBI:5728) has role plant metabolite (CHEBI:76924) |
| hirsutidin (CHEBI:5728) is a 5-hydroxyanthocyanidin (CHEBI:140277) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-1-benzopyran-1-ium |
| Manual Xrefs | Databases |
|---|---|
| C00006619 | KNApSAcK |
| C08643 | KEGG COMPOUND |
| Hirsutidin | Wikipedia |
| LMPK12010421 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6118726 | Reaxys |
| CAS:4092-66-4 | KEGG COMPOUND |
| Citations |
|---|