EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12I3NO4 |
| Net Charge | 0 |
| Average Mass | 650.976 |
| Monoisotopic Mass | 650.79005 |
| SMILES | [NH3+][C@@H](Cc1ccc(Oc2cc(I)c(O)c(I)c2)c(I)c1)C(=O)[O-] |
| InChI | InChI=1S/C15H12I3NO4/c16-9-3-7(4-12(19)15(21)22)1-2-13(9)23-8-5-10(17)14(20)11(18)6-8/h1-3,5-6,12,20H,4,19H2,(H,21,22)/t12-/m0/s1 |
| InChIKey | HZCBWYNLGPIQRK-LBPRGKRZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5'-triiodo-L-thyronine zwitterion (CHEBI:57261) is a amino-acid zwitterion (CHEBI:35238) |
| 3,3',5'-triiodo-L-thyronine zwitterion (CHEBI:57261) is tautomer of 3,3',5'-triiodo-L-thyronine (CHEBI:11684) |
| Incoming Relation(s) |
| 3,3',5'-triiodo-L-thyronine sulfate(1−) (CHEBI:176513) has functional parent 3,3',5'-triiodo-L-thyronine zwitterion (CHEBI:57261) |
| 3,3',5'-triiodo-L-thyronine (CHEBI:11684) is tautomer of 3,3',5'-triiodo-L-thyronine zwitterion (CHEBI:57261) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenyl]propanoate |
| UniProt Name | Source |
|---|---|
| 3,3',5'-triiodo-L-thyronine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-10813 | MetaCyc |