EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O6 |
| Net Charge | 0 |
| Average Mass | 354.358 |
| Monoisotopic Mass | 354.11034 |
| SMILES | O=C1OC[C@H](Cc2ccc3c(c2)OCO3)[C@H]1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15H,5-6,9-11H2/t14-,15+/m0/s1 |
| InChIKey | DDWGQGZPYDSYEL-LSDHHAIUSA-N |
| Roles Classification |
|---|
| Biological Role: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hinokinin (CHEBI:5722) has role trypanocidal drug (CHEBI:36335) |
| hinokinin (CHEBI:5722) is a benzodioxoles (CHEBI:38298) |
| hinokinin (CHEBI:5722) is a lignan (CHEBI:25036) |
| hinokinin (CHEBI:5722) is a γ-lactone (CHEBI:37581) |
| Synonyms | Source |
|---|---|
| Hinokinin | KEGG COMPOUND |
| (3R,4R)-3,4-bis(1,3-benzodioxol-5-ylmethyl)dihydrofuran-2(3H)-one | IUPAC |
| (−)-hinokinin | ChEBI |
| (3R-trans)-3,4-bis(1,3-benzodioxol-5-ylmethyl)dihydrofuran-2(3H)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:95369 | Reaxys |
| CAS:26543-89-5 | KEGG COMPOUND |
| CAS:26543-89-5 | ChemIDplus |
| Citations |
|---|