EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | O=c1cc(-c2ccc(Oc3c(O)cc4oc(-c5ccc(O)cc5)cc(=O)c4c3O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C30H18O10/c31-16-5-1-14(2-6-16)24-12-21(35)28-26(40-24)13-22(36)30(29(28)37)38-18-7-3-15(4-8-18)23-11-20(34)27-19(33)9-17(32)10-25(27)39-23/h1-13,31-33,36-37H |
| InChIKey | WTDHMFBJQJSTMH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhus succedanea (ncbitaxon:269721) | fruit (BTO:0000486) | PubMed (2526343) | drupes |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hinokiflavone (CHEBI:5721) has functional parent apigenin (CHEBI:18388) |
| hinokiflavone (CHEBI:5721) has role antineoplastic agent (CHEBI:35610) |
| hinokiflavone (CHEBI:5721) has role metabolite (CHEBI:25212) |
| hinokiflavone (CHEBI:5721) has role neuroprotective agent (CHEBI:63726) |
| hinokiflavone (CHEBI:5721) is a aromatic ether (CHEBI:35618) |
| hinokiflavone (CHEBI:5721) is a biflavonoid (CHEBI:50128) |
| hinokiflavone (CHEBI:5721) is a hydroxyflavone (CHEBI:24698) |
| IUPAC Name |
|---|
| 6-[4-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)phenoxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Hinokiflavone | KEGG COMPOUND |
| 4',6''-O-biapigenin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10057 | KEGG COMPOUND |
| LMPK12040004 | LIPID MAPS |
| EP1245230 | Patent |
| WO9700679 | Patent |
| C00001049 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:379316 | Reaxys |
| CAS:19202-36-9 | KEGG COMPOUND |
| CAS:19202-36-9 | ChemIDplus |
| Citations |
|---|