EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N2O3 |
| Net Charge | 0 |
| Average Mass | 236.271 |
| Monoisotopic Mass | 236.11609 |
| SMILES | CN1C(=O)NC(=O)C(C)(C2=CCCCC2)C1=O |
| InChI | InChI=1S/C12H16N2O3/c1-12(8-6-4-3-5-7-8)9(15)13-11(17)14(2)10(12)16/h6H,3-5,7H2,1-2H3,(H,13,15,17) |
| InChIKey | UYXAWHWODHRRMR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Application: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexobarbital (CHEBI:5706) has functional parent barbituric acid (CHEBI:16294) |
| hexobarbital (CHEBI:5706) is a barbiturates (CHEBI:22693) |
| IUPAC Name |
|---|
| 5-(cyclohex-1-en-1-yl)-1,5-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms | Source |
|---|---|
| Hexobarbitone | KEGG COMPOUND |
| Hexobarbital | KEGG COMPOUND |
| 5-(1-cyclohexen-1-yl)-1,5-dimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione | NIST Chemistry WebBook |
| 5-(1-cyclohexen-1-yl)-1,5-dimethylbarbituric acid | NIST Chemistry WebBook |
| Evipan | ChemIDplus |
| methexenyl | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11723 | KEGG COMPOUND |
| DB01355 | DrugBank |
| Hexobarbital | Wikipedia |
| HMDB0015444 | HMDB |
| D01071 | KEGG DRUG |
| 1369 | DrugCentral |
| Citations |
|---|