EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H6Cl6O2 |
| Net Charge | 0 |
| Average Mass | 406.907 |
| Monoisotopic Mass | 403.84990 |
| SMILES | Oc1c(Cl)cc(Cl)c(Cl)c1Cc1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H6Cl6O2/c14-6-2-8(16)12(20)4(10(6)18)1-5-11(19)7(15)3-9(17)13(5)21/h2-3,20-21H,1H2 |
| InChIKey | ACGUYXCXAPNIKK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexachlorophene (CHEBI:5693) has role acaricide (CHEBI:22153) |
| hexachlorophene (CHEBI:5693) has role antibacterial agent (CHEBI:33282) |
| hexachlorophene (CHEBI:5693) has role antifungal agrochemical (CHEBI:86328) |
| hexachlorophene (CHEBI:5693) has role antiseptic drug (CHEBI:48218) |
| hexachlorophene (CHEBI:5693) is a bridged diphenyl fungicide (CHEBI:87039) |
| hexachlorophene (CHEBI:5693) is a polyphenol (CHEBI:26195) |
| hexachlorophene (CHEBI:5693) is a trichlorobenzene (CHEBI:27096) |
| IUPAC Name |
|---|
| 2,2'-methylenebis(3,4,6-trichlorophenol) |
| INNs | Source |
|---|---|
| hexachlorophene | WHO MedNet |
| hexachlorophène | WHO MedNet |
| hexachlorophenum | WHO MedNet |
| hexaclorofeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2,2',3,3',5,5'-hexachloro-6,6'-dihydroxydiphenylmethane | NIST Chemistry WebBook |
| 2,2'-dihydroxy-3,3',5,5',6,6'-hexachlorodiphenylmethane | NIST Chemistry WebBook |
| 2,2'-dihydroxy-3,5,6,3',5',6'-hexachlorodiphenylmethane | NIST Chemistry WebBook |
| 2,2'-methanediylbis(3,4,6-trichlorophenol) | PDBeChem |
| bis(2-hydroxy-3,5,6-trichlorophenyl)methane | NIST Chemistry WebBook |
| bis(3,5,6-trichloro-2-hydroxyphenyl)methane | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Acigena | ChemIDplus |
| Almederm | ChemIDplus |
| Armohex | ChemIDplus |
| Distodin | ChemIDplus |
| Esaclorofene | ChemIDplus |
| Exofene | ChemIDplus |
| Citations |
|---|