EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6Cl6 |
| Net Charge | 0 |
| Average Mass | 284.784 |
| Monoisotopic Mass | 281.81312 |
| SMILES | Clc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | CKAPSXZOOQJIBF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexachlorobenzene (CHEBI:5692) has role antifungal agrochemical (CHEBI:86328) |
| hexachlorobenzene (CHEBI:5692) has role carcinogenic agent (CHEBI:50903) |
| hexachlorobenzene (CHEBI:5692) has role persistent organic pollutant (CHEBI:77853) |
| hexachlorobenzene (CHEBI:5692) is a aromatic fungicide (CHEBI:87034) |
| hexachlorobenzene (CHEBI:5692) is a chlorobenzenes (CHEBI:23132) |
| IUPAC Name |
|---|
| hexachlorobenzene |
| Synonyms | Source |
|---|---|
| Hexachlorobenzene | KEGG COMPOUND |
| perchlorobenzene | ChemIDplus |
| Hexachlorbenzol | ChemIDplus |
| 1,2,3,4,5,6-hexachlorobenzene | NIST Chemistry WebBook |
| phenyl perchloryl | NIST Chemistry WebBook |
| HCB | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C11042 | KEGG COMPOUND |
| Hexachlorobenzene | Wikipedia |
| HMDB0032566 | HMDB |
| 380 | PPDB |
| Citations |
|---|