EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO3 |
| Net Charge | 0 |
| Average Mass | 299.370 |
| Monoisotopic Mass | 299.15214 |
| SMILES | [H][C@@]12C=C[C@H](OC)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C18H21NO3/c1-19-8-7-18-11-4-6-14(21-2)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19/h3-6,11-12,14,17,20H,7-9H2,1-2H3/t11-,12+,14-,17-,18-/m0/s1 |
| InChIKey | FNAHUZTWOVOCTL-XSSYPUMDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Heterocodeine (CHEBI:5685) is a morphinane alkaloid (CHEBI:25418) |
| Synonym | Source |
|---|---|
| Heterocodeine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11779 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:639-47-4 | KEGG COMPOUND |