EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12ClN5O3 |
| Net Charge | 0 |
| Average Mass | 285.691 |
| Monoisotopic Mass | 285.06287 |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C10H12ClN5O3/c11-10-14-8(12)7-9(15-10)16(3-13-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H2,12,14,15)/t4-,5+,6+/m0/s1 |
| InChIKey | PTOAARAWEBMLNO-KVQBGUIXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cladribine (CHEBI:567361) has role antineoplastic agent (CHEBI:35610) |
| cladribine (CHEBI:567361) has role immunosuppressive agent (CHEBI:35705) |
| cladribine (CHEBI:567361) is a organochlorine compound (CHEBI:36683) |
| cladribine (CHEBI:567361) is a purine 2'-deoxyribonucleoside (CHEBI:19254) |
| IUPAC Name |
|---|
| 2-chloro-2'-deoxyadenosine |
| INNs | Source |
|---|---|
| cladribina | ChEBI |
| cladribine | ChemIDplus |
| cladribinum | ChEBI |
| Synonyms | Source |
|---|---|
| 2-CdA | ChemIDplus |
| 2-chloro-2'-deoxy-β-adenosine | ChemIDplus |
| 2-chloro-6-amino-9-(2-deoxy-β-D-erythro-pentofuranosyl)purine | ChEBI |
| 2-chloro-deoxyadenosine | ChEMBL |
| 2-chlorodeoxyadenosine | ChemIDplus |
| 2ClAdo | ChEBI |
| Citations |
|---|