EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:566519 - 3,4,5-trimethoxycinnamic acid
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | [H]C(=Cc1cc(OC)c(OC)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C12H14O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H,13,14) |
| InChIKey | YTFVRYKNXDADBI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5-trimethoxycinnamic acid (CHEBI:566519) has role allergen (CHEBI:50904) |
| 3,4,5-trimethoxycinnamic acid (CHEBI:566519) is a methoxycinnamic acid (CHEBI:61407) |
| 3,4,5-trimethoxycinnamic acid (CHEBI:566519) is conjugate acid of 3,4,5-trimethoxycinnamate (CHEBI:58949) |
| Incoming Relation(s) |
| 3,4,5-trimethoxycinnamate (CHEBI:58949) is conjugate base of 3,4,5-trimethoxycinnamic acid (CHEBI:566519) |
| IUPAC Name |
|---|
| 3-(3,4,5-trimethoxyphenyl)acrylic acid |
| Synonyms | Source |
|---|---|
| 3-(3,4,5-trimethoxyphenyl)acrylic acid | ChEMBL |
| 3,4,5-Trimethoxyphenylacrylic acid | ChemIDplus |
| 3-(3,4,5-Trimethoxyphenyl)-2-propenoic acid | ChemIDplus |
| O-Methylsinapic acid | ChemIDplus |
| TMCA | ChEBI |
| Citations |
|---|