EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H62O |
| Net Charge | 0 |
| Average Mass | 450.836 |
| Monoisotopic Mass | 450.48007 |
| SMILES | CCCCCCCCCCCCCCCC(=O)CCCCCCCCCCCCCCC |
| InChI | InChI=1S/C31H62O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31(32)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-30H2,1-2H3 |
| InChIKey | UNRFDARCMOHDBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hentriacontan-16-one (CHEBI:5658) has parent hydride hentriacontane (CHEBI:5659) |
| hentriacontan-16-one (CHEBI:5658) has role anticonvulsant (CHEBI:35623) |
| hentriacontan-16-one (CHEBI:5658) has role metabolite (CHEBI:25212) |
| hentriacontan-16-one (CHEBI:5658) is a dialkyl ketone (CHEBI:18044) |
| IUPAC Name |
|---|
| hentriacontan-16-one |
| Synonyms | Source |
|---|---|
| Hentriacontan-16-one | KEGG COMPOUND |
| 16-Hentriacontanone | KEGG COMPOUND |
| palmitone | ChemIDplus |
| dipentadecyl ketone | NIST Chemistry WebBook |
| Citations |
|---|