EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O2 |
| Net Charge | 0 |
| Average Mass | 160.172 |
| Monoisotopic Mass | 160.05243 |
| SMILES | Cc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C10H8O2/c1-7-2-4-9-8(6-7)3-5-10(11)12-9/h2-6H,1H3 |
| InChIKey | FXFYOPQLGGEACP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methylcoumarin (CHEBI:563586) has role allergen (CHEBI:50904) |
| 6-methylcoumarin (CHEBI:563586) has role fragrance (CHEBI:48318) |
| 6-methylcoumarin (CHEBI:563586) is a coumarins (CHEBI:23403) |
| IUPAC Name |
|---|
| 6-methyl-2H-chromen-2-one |
| Synonyms | Source |
|---|---|
| 6-methyl-2H-1-benzopyran-2-one | ChEBI |
| Methyl coumarin | ChemIDplus |
| 6-Methyl-cis-O-coumarinic lactone | ChemIDplus |
| 6-Methylbenzopyrone | ChemIDplus |
| 6-Methyl-1,2-benzopyrone | ChemIDplus |
| 5-Methyl-2-hydroxyphenylpropenoic acid lactone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0032394 | HMDB |
| Citations |
|---|