EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37NO9 |
| Net Charge | 0 |
| Average Mass | 531.602 |
| Monoisotopic Mass | 531.24683 |
| SMILES | [H][C@]12c3cc4c(cc3CCN3CCC[C@@]31C=C(OC)[C@H]2OC(=O)[C@@](O)(CCC(C)(C)O)CC(=O)OC)OCO4 |
| InChI | InChI=1S/C28H37NO9/c1-26(2,32)8-9-28(33,15-22(30)35-4)25(31)38-24-21(34-3)14-27-7-5-10-29(27)11-6-17-12-19-20(37-16-36-19)13-18(17)23(24)27/h12-14,23-24,32-33H,5-11,15-16H2,1-4H3/t23-,24-,27+,28-/m1/s1 |
| InChIKey | HAVJATCHLFRDHY-KSZYUSJVSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Harringtonine (CHEBI:5626) is a alkaloid (CHEBI:22315) |
| Synonym | Source |
|---|---|
| Harringtonine | KEGG COMPOUND |