EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23ClFNO2 |
| Net Charge | 0 |
| Average Mass | 375.871 |
| Monoisotopic Mass | 375.14013 |
| SMILES | O=C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23ClFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2 |
| InChIKey | LNEPOXFFQSENCJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. antidyskinesia agent Any compound which can be used to treat or alleviate the symptoms of dyskinesia. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| haloperidol (CHEBI:5613) has role antidyskinesia agent (CHEBI:66956) |
| haloperidol (CHEBI:5613) has role antiemetic (CHEBI:50919) |
| haloperidol (CHEBI:5613) has role dopaminergic antagonist (CHEBI:48561) |
| haloperidol (CHEBI:5613) has role first generation antipsychotic (CHEBI:65190) |
| haloperidol (CHEBI:5613) has role serotonergic antagonist (CHEBI:48279) |
| haloperidol (CHEBI:5613) is a aromatic ketone (CHEBI:76224) |
| haloperidol (CHEBI:5613) is a hydroxypiperidine (CHEBI:48590) |
| haloperidol (CHEBI:5613) is a monochlorobenzenes (CHEBI:83403) |
| haloperidol (CHEBI:5613) is a organofluorine compound (CHEBI:37143) |
| haloperidol (CHEBI:5613) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one |
| INNs | Source |
|---|---|
| haloperidol | KEGG DRUG |
| haloperidolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(3-p-fluorobenzoylpropyl)-4-p-chlorophenyl-4-hydroxypiperidine | ChemIDplus |
| 4-[4-(4-chlorophenyl)-4-hydroxy-1-piperidyl]-1-(4-fluorophenyl)-butan-1-one | IUPHAR |
| 4-(4-(para-chlorophenyl)-4-hydroxypiperidino)-4'-fluorobutyrophenone | NIST Chemistry WebBook |
| 4'-fluoro-4-(4-(p-chlorophenyl)-4-hydroxypiperidinyl)butyrophenone | NIST Chemistry WebBook |
| 4'-fluoro-4-(4-hydroxy-4-(4'-chlorophenyl)piperidino)butyrophenone | NIST Chemistry WebBook |
| γ-(4-(p-chlorophenyl)-4-hydroxpiperidino)-p-fluorbutyrophenone | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Haldol | KEGG DRUG |
| Citations |
|---|