EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28N6O7S3 |
| Net Charge | 0 |
| Average Mass | 620.735 |
| Monoisotopic Mass | 620.11816 |
| SMILES | [H][C@]12SCC(/C=C\c3scnc3C)=C(C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C25H28N6O7S3/c1-12-15(41-10-27-12)7-6-13-8-39-21-17(29-19(32)16(30-36-5)14-9-40-24(26)28-14)20(33)31(21)18(13)22(34)37-11-38-23(35)25(2,3)4/h6-7,9-10,17,21H,8,11H2,1-5H3,(H2,26,28)(H,29,32)/b7-6-,30-16-/t17-,21-/m1/s1 |
| InChIKey | AFZFFLVORLEPPO-UVYJNCLZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefditoren pivoxil (CHEBI:560555) has functional parent cefditoren (CHEBI:59343) |
| cefditoren pivoxil (CHEBI:560555) has role antibacterial drug (CHEBI:36047) |
| cefditoren pivoxil (CHEBI:560555) has role prodrug (CHEBI:50266) |
| cefditoren pivoxil (CHEBI:560555) is a 1,3-thiazoles (CHEBI:38418) |
| cefditoren pivoxil (CHEBI:560555) is a cephams (CHEBI:35995) |
| cefditoren pivoxil (CHEBI:560555) is a oxime O-ether (CHEBI:36816) |
| cefditoren pivoxil (CHEBI:560555) is a pivaloyloxymethyl ester (CHEBI:136685) |
| IUPAC Names |
|---|
| [(2,2-dimethylpropanoyl)oxy]methyl (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(Z)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| [(2,2-dimethylpropanoyl)oxy]methyl 7β-(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido-3-[(Z)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-3,4-didehydrocepham-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| Cefditoren pivoxil | KEGG COMPOUND |
| cefditoren pivaloyloxymethyl ester | ChemIDplus |
| pivaloyloxymethyl (+)-(6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(Z)-2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01628 | KEGG DRUG |
| DB01066 | DrugBank |
| Cefditoren_Pivoxil | Wikipedia |
| 534 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4902739 | Beilstein |
| CAS:117467-28-4 | KEGG DRUG |
| CAS:117467-28-4 | ChemIDplus |