EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12ClF3N2O |
| Net Charge | 0 |
| Average Mass | 352.743 |
| Monoisotopic Mass | 352.05903 |
| SMILES | O=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1CC(F)(F)F |
| InChI | InChI=1S/C17H12ClF3N2O/c18-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)22-9-15(24)23(14)10-17(19,20)21/h1-8H,9-10H2 |
| InChIKey | WYCLKVQLVUQKNZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Halazepam (CHEBI:5603) has role anxiolytic drug (CHEBI:35474) |
| Halazepam (CHEBI:5603) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Halazepam | KEGG COMPOUND |
| Halazepam civ | ChEMBL |
| paxipam | DrugCentral |
| Paxipam (TN) | KEGG COMPOUND |
| SCH 12041 | ChEMBL |
| SCH-12041 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1348 | DrugCentral |
| D00338 | KEGG DRUG |
| HMDB0014939 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:23092-17-3 | KEGG COMPOUND |
| Citations |
|---|