EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO4 |
| Net Charge | 0 |
| Average Mass | 301.342 |
| Monoisotopic Mass | 301.13141 |
| SMILES | [H][C@]12C[C@H](OC)C=C[C@]13c1cc4c(cc1C[N@@]2C[C@@H]3O)OCO4 |
| InChI | InChI=1S/C17H19NO4/c1-20-11-2-3-17-12-6-14-13(21-9-22-14)4-10(12)7-18(8-16(17)19)15(17)5-11/h2-4,6,11,15-16,19H,5,7-9H2,1H3/t11-,15+,16+,17+/m1/s1 |
| InChIKey | YGPRSGKVLATIHT-HSHDSVGOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Haemanthamine (CHEBI:5600) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| Haemanthamine | KEGG COMPOUND |
| (3beta,5alpha,11R,13beta,19alpha)-1,2-Didehydro-3-methoxycrinan-11-ol | KEGG COMPOUND |
| (+)-Haemanthamine | KEGG COMPOUND |