EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H66O14 |
| Net Charge | 0 |
| Average Mass | 806.987 |
| Monoisotopic Mass | 806.44526 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)[C@@H](OC(=O)/C(C)=C/C)[C@H](O)[C@]4(COC(C)=O)[C@@H](O)C[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@@]1(C)CO |
| InChI | InChI=1S/C43H66O14/c1-10-21(2)36(53)57-34-33(50)43(20-54-22(3)45)24(17-38(34,4)5)23-11-12-26-39(6)15-14-28(55-37-31(49)29(47)30(48)32(56-37)35(51)52)40(7,19-44)25(39)13-16-41(26,8)42(23,9)18-27(43)46/h10-11,24-34,37,44,46-50H,12-20H2,1-9H3,(H,51,52)/b21-10+/t24-,25+,26+,27-,28-,29-,30-,31+,32-,33-,34-,37+,39-,40-,41+,42+,43-/m0/s1 |
| InChIKey | VEFSVJGWJQPWFS-ZXKKMYOJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gymnemic acid I (CHEBI:5577) is a triterpenoid saponin (CHEBI:61778) |
| Synonym | Source |
|---|---|
| Gymnemic acid I | KEGG COMPOUND |