EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H41N7 |
| Net Charge | 0 |
| Average Mass | 355.575 |
| Monoisotopic Mass | 355.34234 |
| SMILES | N=C(N)NCCCCCCCCNCCCCCCCCNC(=N)N |
| InChI | InChI=1S/C18H41N7/c19-17(20)24-15-11-7-3-1-5-9-13-23-14-10-6-2-4-8-12-16-25-18(21)22/h23H,1-16H2,(H4,19,20,24)(H4,21,22,25) |
| InChIKey | RONFGUROBZGJKP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iminoctadine (CHEBI:5569) has role antifungal agrochemical (CHEBI:86328) |
| iminoctadine (CHEBI:5569) is a aliphatic nitrogen antifungal agent (CHEBI:86417) |
| iminoctadine (CHEBI:5569) is a guanidines (CHEBI:24436) |
| iminoctadine (CHEBI:5569) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| guazatine (CHEBI:82843) has part iminoctadine (CHEBI:5569) |
| IUPAC Name |
|---|
| 1,1'-(iminodioctane-8,1-diyl)diguanidine |
| Synonym | Source |
|---|---|
| Guazatine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C10997 | KEGG COMPOUND |
| GZZ | PDBeChem |
| iminoctadine | Alan Wood's Pesticides |
| 398 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1995978 | Reaxys |
| CAS:13516-27-3 | KEGG COMPOUND |
| CAS:13516-27-3 | ChemIDplus |