EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H40N2O6 |
| Net Charge | 0 |
| Average Mass | 596.724 |
| Monoisotopic Mass | 596.28864 |
| SMILES | COc1cc2c(cc1O)[C@@H](Cc1ccc(Oc3cc(C[C@@H]4c5cc(O)c(OC)cc5CCN4C)ccc3O)cc1)N(C)CC2 |
| InChI | InChI=1S/C36H40N2O6/c1-37-13-11-24-18-34(42-3)32(40)20-27(24)29(37)15-22-5-8-26(9-6-22)44-36-17-23(7-10-31(36)39)16-30-28-21-33(41)35(43-4)19-25(28)12-14-38(30)2/h5-10,17-21,29-30,39-41H,11-16H2,1-4H3/t29-,30-/m1/s1 |
| InChIKey | FDABVSXGAMFQQH-LOYHVIPDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guattegaumerine (CHEBI:5568) has functional parent dauricine (CHEBI:4331) |
| guattegaumerine (CHEBI:5568) is a aromatic ether (CHEBI:35618) |
| guattegaumerine (CHEBI:5568) is a bisbenzylisoquinoline alkaloid (CHEBI:133004) |
| guattegaumerine (CHEBI:5568) is a phenols (CHEBI:33853) |
| guattegaumerine (CHEBI:5568) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (1R)-1-[4-(2-hydroxy-5-{[(1R)-7-hydroxy-6-methoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl}phenoxy)benzyl]-6-methoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-7-ol |
| Synonyms | Source |
|---|---|
| 7,7'-Demethyldauricine | ChemIDplus |
| 7-Isoquinolinol, 1,2,3,4-tetrahydro-1-((4-(2-hydroxy-5-((1,2,3,4-tetrahydro-7-hydroxy-6-methoxy-2-methyl-1-isoquinolinyl)methyl)phenoxy)phenyl)methyl)-6-methoxy-2-methyl-, (R-(R*,R*))- | ChemIDplus |
| Dauriciline | ChemIDplus |
| (−)-N,N-dimethyllindoldhamine | ChEBI |
| Guattegaumerine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1523406 | Reaxys |
| CAS:21446-35-5 | KEGG COMPOUND |
| CAS:21446-35-5 | ChemIDplus |
| Citations |
|---|