EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8Cl2O2S |
| Net Charge | 0 |
| Average Mass | 287.167 |
| Monoisotopic Mass | 285.96221 |
| SMILES | Oc1ccc(Cl)cc1Sc1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H8Cl2O2S/c13-7-1-3-9(15)11(5-7)17-12-6-8(14)2-4-10(12)16/h1-6,15-16H |
| InChIKey | ANUSOIHIIPAHJV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenticlor (CHEBI:556580) has role antiinfective agent (CHEBI:35441) |
| fenticlor (CHEBI:556580) has role drug allergen (CHEBI:88188) |
| fenticlor (CHEBI:556580) is a aryl sulfide (CHEBI:35683) |
| fenticlor (CHEBI:556580) is a bridged diphenyl antifungal drug (CHEBI:87110) |
| fenticlor (CHEBI:556580) is a monochlorobenzenes (CHEBI:83403) |
| fenticlor (CHEBI:556580) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 2,2'-sulfanediylbis(4-chlorophenol) |
| INNs | Source |
|---|---|
| fenticlor | KEGG DRUG |
| fenticlor | WHO MedNet |
| fenticloro | ChemIDplus |
| fenticlorum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2,2'-Dihydroxy-5,5'-dichlorodiphenyl sulfide | NIST Chemistry WebBook |
| 2,2'-Dihydroxy-5,5'-dichlorophenyl sulfide | ChemIDplus |
| 2,2'-Thiobis(4-chlorophenol) | ChemIDplus |
| 2,2'-Thiobis4-chlorophenol | NIST Chemistry WebBook |
| 4,4'-dichloro-2,2'-thiodiphenol | ChEBI |
| 5,5'-Dichloro-2,2'-dihydroxydiphenyl sulfide | ChemIDplus |
| Citations |
|---|