EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9Cl2N3O.HCl |
| Net Charge | 0 |
| Average Mass | 282.558 |
| Monoisotopic Mass | 280.98894 |
| SMILES | Cl.N=C(N)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O.ClH/c10-6-2-1-3-7(11)5(6)4-8(15)14-9(12)13;/h1-3H,4H2,(H4,12,13,14,15);1H |
| InChIKey | DGFYECXYGUIODH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guanfacine hydrochloride (CHEBI:5559) has role antihypertensive agent (CHEBI:35674) |
| Guanfacine hydrochloride (CHEBI:5559) has role geroprotector (CHEBI:176497) |
| Guanfacine hydrochloride (CHEBI:5559) is a acetamides (CHEBI:22160) |
| Synonyms | Source |
|---|---|
| BS 100-141 | ChEMBL |
| BS-100-141 | ChEMBL |
| Guafacine hydrochloride | ChEMBL |
| Guanfacine hydrochloride | KEGG COMPOUND |
| SPD503 | ChEMBL |
| Tenex (TN) | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Akfen | ChEMBL |
| Estulic | ChEMBL |
| Tenex | ChEMBL |
| Citations |
|---|