EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9Cl2N3O.HCl |
| Net Charge | 0 |
| Average Mass | 282.558 |
| Monoisotopic Mass | 280.98894 |
| SMILES | Cl.N=C(N)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O.ClH/c10-6-2-1-3-7(11)5(6)4-8(15)14-9(12)13;/h1-3H,4H2,(H4,12,13,14,15);1H |
| InChIKey | DGFYECXYGUIODH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guanfacine hydrochloride (CHEBI:5559) has role geroprotector (CHEBI:176497) |
| Guanfacine hydrochloride (CHEBI:5559) is a acetamides (CHEBI:22160) |
| Synonyms | Source |
|---|---|
| Guanfacine hydrochloride | KEGG COMPOUND |
| Tenex (TN) | KEGG COMPOUND |
| Citations |
|---|