EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9Cl2N3O |
| Net Charge | 0 |
| Average Mass | 246.097 |
| Monoisotopic Mass | 245.01227 |
| SMILES | N=C(N)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O/c10-6-2-1-3-7(11)5(6)4-8(15)14-9(12)13/h1-3H,4H2,(H4,12,13,14,15) |
| InChIKey | INJOMKTZOLKMBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guanfacine (CHEBI:5558) has role antidepressant (CHEBI:35469) |
| Guanfacine (CHEBI:5558) has role antihypertensive agent (CHEBI:35674) |
| Guanfacine (CHEBI:5558) is a acetamides (CHEBI:22160) |
| INN | Source |
|---|---|
| guanfacina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Guanfacine | KEGG COMPOUND |
| guanfacine HCl | DrugCentral |
| guanfacine hydrochloride | DrugCentral |
| guanfacine monohydrochloride | DrugCentral |
| NSC-759121 | ChEMBL |
| Brand Name | Source |
|---|---|
| Intuniv | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1343 | DrugCentral |
| C07037 | KEGG COMPOUND |
| D08031 | KEGG DRUG |
| HMDB0015153 | HMDB |
| LSM-2716 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:29110-47-2 | KEGG COMPOUND |
| Citations |
|---|