EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9Cl2N3O |
| Net Charge | 0 |
| Average Mass | 246.097 |
| Monoisotopic Mass | 245.01227 |
| SMILES | N=C(N)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O/c10-6-2-1-3-7(11)5(6)4-8(15)14-9(12)13/h1-3H,4H2,(H4,12,13,14,15) |
| InChIKey | INJOMKTZOLKMBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guanfacine (CHEBI:5558) has role antidepressant (CHEBI:35469) |
| Guanfacine (CHEBI:5558) has role antihypertensive agent (CHEBI:35674) |
| Guanfacine (CHEBI:5558) is a acetamides (CHEBI:22160) |
| INN | Source |
|---|---|
| guanfacina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Guanfacine | KEGG COMPOUND |
| guanfacine HCl | DrugCentral |
| guanfacine hydrochloride | DrugCentral |
| guanfacine monohydrochloride | DrugCentral |
| NSC-759121 | ChEMBL |
| Brand Name | Source |
|---|---|
| Intuniv | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1343 | DrugCentral |
| C07037 | KEGG COMPOUND |
| D08031 | KEGG DRUG |
| HMDB0015153 | HMDB |
| LSM-2716 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:29110-47-2 | KEGG COMPOUND |
| Citations |
|---|