EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C10H19N3O2.H2O4S |
| Net Charge | 0 |
| Average Mass | 524.641 |
| Monoisotopic Mass | 524.26283 |
| SMILES | N=C(N)NCC1COC2(CCCCC2)O1.N=C(N)NCC1COC2(CCCCC2)O1.O=S(=O)(O)O |
| InChI | InChI=1S/2C10H19N3O2.H2O4S/c2*11-9(12)13-6-8-7-14-10(15-8)4-2-1-3-5-10;1-5(2,3)4/h2*8H,1-7H2,(H4,11,12,13);(H2,1,2,3,4) |
| InChIKey | RTEVGQJRTFFMLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanadrel sulfate (CHEBI:5556) has part guanadrel(1+) (CHEBI:72602) |
| guanadrel sulfate (CHEBI:5556) has role adrenergic antagonist (CHEBI:37887) |
| guanadrel sulfate (CHEBI:5556) has role antihypertensive agent (CHEBI:35674) |
| guanadrel sulfate (CHEBI:5556) is a organic sulfate salt (CHEBI:51337) |
| IUPAC Name |
|---|
| 1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine sulfate |
| Synonyms | Source |
|---|---|
| bis{amino[(1,4-dioxaspiro[4.5]dec-2-ylmethyl)amino]methaniminium} sulfate | IUPAC |
| CL 1388R | ChemIDplus |
| CL-1388R | ChemIDplus |
| U 28288D | ChemIDplus |
| U-28,288D | ChemIDplus |
| Brand Names | Source |
|---|---|
| Anarel | ChEBI |
| Hylorel | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D00607 | KEGG DRUG |
| DBSALT000889 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13410559 | Reaxys |
| CAS:22195-34-2 | ChemIDplus |
| CAS:22195-34-2 | KEGG DRUG |
| Citations |
|---|