EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29NO3 |
| Net Charge | 0 |
| Average Mass | 283.412 |
| Monoisotopic Mass | 283.21474 |
| SMILES | CCCCCCCCCCCC(=O)N[C@@H]1CCOC1=O |
| InChI | InChI=1S/C16H29NO3/c1-2-3-4-5-6-7-8-9-10-11-15(18)17-14-12-13-20-16(14)19/h14H,2-13H2,1H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | WILLZMOKUUPJSL-CQSZACIVSA-N |
| Roles Classification |
|---|
| Biological Role: | autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-dodecanoyl-L-homoserine lactone (CHEBI:55555) is a N-acyl-L-homoserine lactone (CHEBI:55474) |
| IUPAC Name |
|---|
| N-[(3R)-2-oxotetrahydrofuran-3-yl]dodecanamide |
| Synonyms | Source |
|---|---|
| N-lauroyl-L-homoserine lactone | ChEBI |
| N-dodecanoyl-S-homoserine lactone | ChEBI |
| C12-HSL | ChEBI |
| N-lauroyl-S-homoserine lactone | ChEBI |
| Citations |
|---|