EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N2O8P |
| Net Charge | 0 |
| Average Mass | 322.210 |
| Monoisotopic Mass | 322.05660 |
| SMILES | Cc1cn([C@H]2C[C@H](OP(=O)(O)O)[C@@H](CO)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(7(4-13)19-8)20-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/t6-,7+,8+/m0/s1 |
| InChIKey | XXYIANZGUOSQHY-XLPZGREQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thymidine 3'-monophosphate (CHEBI:55552) is a pyrimidine 2'-deoxyribonucleoside 3'-monophosphate (CHEBI:36994) |
| thymidine 3'-monophosphate (CHEBI:55552) is a thymidine phosphate (CHEBI:27001) |
| thymidine 3'-monophosphate (CHEBI:55552) is conjugate acid of thymidine 3'-monophosphate(2−) (CHEBI:77843) |
| Incoming Relation(s) |
| 5-bromo-4-chloro-3-indolyl thymidine 3'-phosphate (CHEBI:91123) has functional parent thymidine 3'-monophosphate (CHEBI:55552) |
| thymidine 3'-monophosphate(2−) (CHEBI:77843) is conjugate base of thymidine 3'-monophosphate (CHEBI:55552) |
| IUPAC Name |
|---|
| 3'-thymidylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:47535 | Reaxys |
| Citations |
|---|