EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O2 |
| Net Charge | 0 |
| Average Mass | 213.281 |
| Monoisotopic Mass | 213.14773 |
| SMILES | N=C(N)NCC1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C10H19N3O2/c11-9(12)13-6-8-7-14-10(15-8)4-2-1-3-5-10/h8H,1-7H2,(H4,11,12,13) |
| InChIKey | HPBNRIOWIXYZFK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. |
| Applications: | adrenergic antagonist An agent that binds to but does not activate adrenergic receptors thereby blocking the actions of endogenous or exogenous adrenergic agonists. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanadrel (CHEBI:5555) has role adrenergic antagonist (CHEBI:37887) |
| guanadrel (CHEBI:5555) has role antihypertensive agent (CHEBI:35674) |
| guanadrel (CHEBI:5555) is a guanidines (CHEBI:24436) |
| guanadrel (CHEBI:5555) is a spiroketal (CHEBI:72600) |
| guanadrel (CHEBI:5555) is conjugate base of guanadrel(1+) (CHEBI:72602) |
| Incoming Relation(s) |
| guanadrel(1+) (CHEBI:72602) is conjugate acid of guanadrel (CHEBI:5555) |
| IUPAC Name |
|---|
| 1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine |
| INNs | Source |
|---|---|
| guanadrel | ChemIDplus |
| guanadrel | WHO MedNet |
| guanadrel | WHO MedNet |
| guanadrelum | ChemIDplus |
| Synonym | Source |
|---|---|
| Guanadrel | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8325419 | Reaxys |
| CAS:40580-59-4 | KEGG COMPOUND |
| CAS:40580-59-4 | ChemIDplus |
| Citations |
|---|