EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:55548 - sulfamoxole
| Formula | C11H13N3O3S |
| Net Charge | 0 |
| Average Mass | 267.310 |
| Monoisotopic Mass | 267.06776 |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(N)cc2)oc1C |
| InChI | InChI=1S/C11H13N3O3S/c1-7-8(2)17-11(13-7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | CYFLXLSBHQBMFT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfamoxole (CHEBI:55548) has role antimicrobial agent (CHEBI:33281) |
| sulfamoxole (CHEBI:55548) has role drug allergen (CHEBI:88188) |
| sulfamoxole (CHEBI:55548) is a oxazole (CHEBI:35790) |
| sulfamoxole (CHEBI:55548) is a sulfonamide (CHEBI:35358) |
| sulfamoxole (CHEBI:55548) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 4-amino-N-(4,5-dimethyl-1,3-oxazol-2-yl)benzenesulfonamide |
| INNs | Source |
|---|---|
| sulfamoxol | ChemIDplus |
| sulfamoxole | ChemIDplus |
| sulfamoxolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(p-Aminobenzenesulfonamido)-4,5-dimethyloxazole | ChemIDplus |
| 2-(p-Aminobenzolsulfonamido)-4,5-dimethyloxazol | ChemIDplus |
| 4,5-Dimethyl-2-sulfanilamidooxazole | ChemIDplus |
| 4-Amino-N-(4,5-dimethyl-2-oxazolyl)benzenesulfonamide | ChemIDplus |
| N1-(4,5-Dimethyl-2-oxazolyl)sulfanilamide | ChemIDplus |
| N(sup 1)-(4,5-Dimethyl-2-oxazolyl)sulfanilamide | ChemIDplus |
| Citations |
|---|