EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2.C8H8Cl2N4 |
| Net Charge | 0 |
| Average Mass | 291.138 |
| Monoisotopic Mass | 290.03373 |
| SMILES | CC(=O)O.N=C(N)N/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H8Cl2N4.C2H4O2/c9-6-2-1-3-7(10)5(6)4-13-14-8(11)12;1-2(3)4/h1-4H,(H4,11,12,14);1H3,(H,3,4)/b13-4+; |
| InChIKey | MCSPBPXATWBACD-GAYQJXMFSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guanabenz acetate (CHEBI:5554) has role geroprotector (CHEBI:176497) |
| Guanabenz acetate (CHEBI:5554) is a dichlorobenzene (CHEBI:23697) |
| Synonyms | Source |
|---|---|
| Guanabenz acetate | KEGG COMPOUND |
| Guanabenz monoacetate | ChEMBL |
| NSC-757044 | ChEMBL |
| WY-8678 ACETATE | ChEMBL |
| Wytensin (TN) | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Wytensin | ChEMBL |
| Citations |
|---|