EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5FO3 |
| Net Charge | 0 |
| Average Mass | 108.068 |
| Monoisotopic Mass | 108.02227 |
| SMILES | O=C(O)[C@H](O)CF |
| InChI | InChI=1S/C3H5FO3/c4-1-2(5)3(6)7/h2,5H,1H2,(H,6,7)/t2-/m1/s1 |
| InChIKey | UYIAUFVPRSSBGY-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-fluorolactic acid (CHEBI:55532) has functional parent propionic acid (CHEBI:30768) |
| (S)-3-fluorolactic acid (CHEBI:55532) is a (2S)-2-hydroxy monocarboxylic acid (CHEBI:17375) |
| (S)-3-fluorolactic acid (CHEBI:55532) is a organofluorine compound (CHEBI:37143) |
| (S)-3-fluorolactic acid (CHEBI:55532) is conjugate acid of (S)-3-fluorolactate (CHEBI:55533) |
| Incoming Relation(s) |
| (S)-3-fluorolactate (CHEBI:55533) is conjugate base of (S)-3-fluorolactic acid (CHEBI:55532) |
| IUPAC Name |
|---|
| (2S)-3-fluoro-2-hydroxypropanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4857799 | Beilstein |