EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO4 |
| Net Charge | 0 |
| Average Mass | 311.337 |
| Monoisotopic Mass | 311.11576 |
| SMILES | O=C(O)[C@H](O)Cc1cnc2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C18H17NO4/c20-17(18(21)22)8-13-10-19-16-7-6-14(9-15(13)16)23-11-12-4-2-1-3-5-12/h1-7,9-10,17,19-20H,8,11H2,(H,21,22)/t17-/m1/s1 |
| InChIKey | WUWWQOPSMGVQAG-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-(5-benzyloxyindol-3-yl)lactic acid (CHEBI:55530) has functional parent 1H-indole (CHEBI:16881) |
| (R)-3-(5-benzyloxyindol-3-yl)lactic acid (CHEBI:55530) has functional parent propionic acid (CHEBI:30768) |
| (R)-3-(5-benzyloxyindol-3-yl)lactic acid (CHEBI:55530) is a (2R)-2-hydroxy monocarboxylic acid (CHEBI:17893) |
| (R)-3-(5-benzyloxyindol-3-yl)lactic acid (CHEBI:55530) is conjugate acid of (R)-3-(5-benzyloxyindol-3-yl)lactate (CHEBI:55531) |
| Incoming Relation(s) |
| (R)-3-(5-benzyloxyindol-3-yl)lactate (CHEBI:55531) is conjugate base of (R)-3-(5-benzyloxyindol-3-yl)lactic acid (CHEBI:55530) |
| IUPAC Name |
|---|
| (2R)-3-[5-(benzyloxy)-1H-indol-3-yl]-2-hydroxypropanoic acid |