EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO3 |
| Net Charge | 0 |
| Average Mass | 205.213 |
| Monoisotopic Mass | 205.07389 |
| SMILES | O=C(O)[C@H](O)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C11H11NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13H,5H2,(H,14,15)/t10-/m1/s1 |
| InChIKey | XGILAAMKEQUXLS-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-indole-3-lactic acid (CHEBI:55528) has functional parent 1H-indole (CHEBI:16881) |
| (R)-indole-3-lactic acid (CHEBI:55528) has functional parent propionic acid (CHEBI:30768) |
| (R)-indole-3-lactic acid (CHEBI:55528) is a (2R)-2-hydroxy monocarboxylic acid (CHEBI:17893) |
| (R)-indole-3-lactic acid (CHEBI:55528) is conjugate acid of (R)-indole-3-lactate (CHEBI:55529) |
| Incoming Relation(s) |
| (R)-indole-3-lactate (CHEBI:55529) is conjugate base of (R)-indole-3-lactic acid (CHEBI:55528) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3-(1H-indol-3-yl)propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6634488 | Beilstein |