EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O3 |
| Net Charge | 0 |
| Average Mass | 172.224 |
| Monoisotopic Mass | 172.10994 |
| SMILES | CCCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C9H16O3/c1-2-3-4-5-6-7-8(10)9(11)12/h2-7H2,1H3,(H,11,12) |
| InChIKey | SHDOPXQMNJDYDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxononanoic acid (CHEBI:55523) has functional parent nonanoic acid (CHEBI:29019) |
| 2-oxononanoic acid (CHEBI:55523) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxononanoic acid (CHEBI:55523) is conjugate acid of 2-oxononanoate (CHEBI:55525) |
| Incoming Relation(s) |
| 2-oxononanoate (CHEBI:55525) is conjugate base of 2-oxononanoic acid (CHEBI:55523) |
| IUPAC Name |
|---|
| 2-oxononanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01060022 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:636253 | Reaxys |