EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H2FO3 |
| Net Charge | -1 |
| Average Mass | 105.044 |
| Monoisotopic Mass | 104.99935 |
| SMILES | O=C([O-])C(=O)CF |
| InChI | InChI=1S/C3H3FO3/c4-1-2(5)3(6)7/h1H2,(H,6,7)/p-1 |
| InChIKey | CXABZTLXNODUTD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-fluoropyruvate (CHEBI:55522) has functional parent pyruvate (CHEBI:15361) |
| 3-fluoropyruvate (CHEBI:55522) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 3-fluoropyruvate (CHEBI:55522) is conjugate base of 3-fluoropyruvic acid (CHEBI:55521) |
| Incoming Relation(s) |
| 3-fluoropyruvic acid (CHEBI:55521) is conjugate acid of 3-fluoropyruvate (CHEBI:55522) |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4858545 | Beilstein |