EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19ClN2O |
| Net Charge | 0 |
| Average Mass | 254.761 |
| Monoisotopic Mass | 254.11859 |
| SMILES | CCCCNCC(=O)Nc1c(C)cccc1Cl |
| InChI | InChI=1S/C13H19ClN2O/c1-3-4-8-15-9-12(17)16-13-10(2)6-5-7-11(13)14/h5-7,15H,3-4,8-9H2,1-2H3,(H,16,17) |
| InChIKey | VWYQKFLLGRBICZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butanilicaine (CHEBI:55518) has role local anaesthetic (CHEBI:36333) |
| butanilicaine (CHEBI:55518) is a amino acid amide (CHEBI:22475) |
| butanilicaine (CHEBI:55518) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| N2-butyl-N-(2-chloro-6-methylphenyl)glycinamide |
| INNs | Source |
|---|---|
| butanilicaina | ChemIDplus |
| butanilicaine | ChemIDplus |
| butanilicainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(Butylamino)-6'-chloro-o-acetoluidide | ChemIDplus |
| 2-Butylamino-6'-chloro-o-acetotoluidide | ChemIDplus |
| 2-(Butylamino)-N-(2-chloro-6-methylphenyl)acetamide | NIST Chemistry WebBook |
| Butacetoluide | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 3691 | DrugCentral |
| Butanilicaine | Wikipedia |
| D07284 | KEGG DRUG |
| Citations |
|---|