EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O4 |
| Net Charge | 0 |
| Average Mass | 198.218 |
| Monoisotopic Mass | 198.08921 |
| SMILES | COc1ccccc1OCC(O)CO |
| InChI | InChI=1S/C10H14O4/c1-13-9-4-2-3-5-10(9)14-7-8(12)6-11/h2-5,8,11-12H,6-7H2,1H3 |
| InChIKey | HSRJKNPTNIJEKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guaifenesin (CHEBI:5551) has role antiinfective agent (CHEBI:35441) |
| Guaifenesin (CHEBI:5551) has role antitussive (CHEBI:51177) |
| Guaifenesin (CHEBI:5551) is a methoxybenzenes (CHEBI:51683) |
| INN | Source |
|---|---|
| guaifenesina | WHO MedNet |
| Synonyms | Source |
|---|---|
| CVT-2534 | ChEMBL |
| glycerin guaiacolate | DrugCentral |
| glycerol guaiacolate | DrugCentral |
| Glyceryl guaiacolate | ChEMBL |
| Guaiacol glyceryl ether | ChEMBL |
| Guaifenesin | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Amonidron | ChEMBL |
| Famel | ChEMBL |
| Franolyn chesty | ChEMBL |
| Gecolate | ChEMBL |
| Guaifenesin component of flowtuss | ChEMBL |
| Guaifenesin component of hycofenix | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1336 | DrugCentral |
| D00337 | KEGG DRUG |
| HMDB0004998 | HMDB |
| LSM-1896 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:93-14-1 | DrugCentral |
| CAS:93-14-1 | KEGG COMPOUND |
| Citations |
|---|