EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18 |
| Net Charge | 0 |
| Average Mass | 198.309 |
| Monoisotopic Mass | 198.14085 |
| SMILES | Cc1ccc(C(C)C)cc2c(C)ccc1-2 |
| InChI | InChI=1S/C15H18/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-10H,1-4H3 |
| InChIKey | FWKQNCXZGNBPFD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guaiazulene (CHEBI:5550) has parent hydride guaiane (CHEBI:36524) |
| guaiazulene (CHEBI:5550) has role ophthalmology drug (CHEBI:66981) |
| guaiazulene (CHEBI:5550) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| 1,4-dimethyl-7-(propan-2-yl)azulene |
| Synonyms | Source |
|---|---|
| 1,4-dimethyl-7-(1-methylethyl)azulene | ChemIDplus |
| 1,4-Dimethyl-7-isopropylazulene | KEGG COMPOUND |
| 3,8-dimethyl-5-(2-propyl)azulene | ChemIDplus |
| 7-isopropyl-1,4-dimethylazulene | IUPAC |
| guaiazulen | ChEMBL |
| Guaiazulen | ChEMBL |
| Citations |
|---|