EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O2 |
| Net Charge | 0 |
| Average Mass | 318.501 |
| Monoisotopic Mass | 318.25588 |
| SMILES | CCCC/C=C\CCCCCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C21H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(22)21(19)23/h5-6,15,17-18,22-23H,2-4,7-14,16H2,1H3/b6-5- |
| InChIKey | WXZPKABXYFJVLD-WAYWQWQTSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| litreol (CHEBI:55497) has role allergen (CHEBI:50904) |
| litreol (CHEBI:55497) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| 3-[(10Z)-pentadec-10-en-1-yl]benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 3-(Pentadec-10-enyl)catechol | ChemIDplus |
| (Z)-3-(10-Pentadecenyl)-1,2-benzenediol | ChemIDplus |
| 3-(10'Z-pentadecenyl)catechol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7816939 | Reaxys |
| CAS:83532-37-0 | ChemIDplus |
| Citations |
|---|