EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N9O5S3 |
| Net Charge | 0 |
| Average Mass | 511.571 |
| Monoisotopic Mass | 511.05148 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C16H17N9O5S3/c1-24-16(20-22-23-24)33-4-6-3-31-13-9(12(27)25(13)10(6)14(28)29)19-11(26)8(21-30-2)7-5-32-15(17)18-7/h5,9,13H,3-4H2,1-2H3,(H2,17,18)(H,19,26)(H,28,29)/b21-8-/t9-,13-/m1/s1 |
| InChIKey | HJJDBAOLQAWBMH-YCRCPZNHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefmenoxime (CHEBI:55490) has role antibacterial drug (CHEBI:36047) |
| cefmenoxime (CHEBI:55490) is a cephalosporin (CHEBI:23066) |
| cefmenoxime (CHEBI:55490) is conjugate acid of cefmenoxime(1−) (CHEBI:55509) |
| Incoming Relation(s) |
| cefmenoxime hydrochloride (CHEBI:31370) has part cefmenoxime (CHEBI:55490) |
| cefmenoxime(1−) (CHEBI:55509) is conjugate base of cefmenoxime (CHEBI:55490) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefmenoxima | ChemIDplus |
| cefmenoxime | ChemIDplus |
| cefmenoximum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-((Z)-2-(2-Amino-4-thiazolyl)-2-methoxyiminoacetamido)-3-((1-methyl-1H-5-tetraazolylthio)methyl)-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-2-carbonsaeure | ChemIDplus |
| (6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (IUPAC) | DrugBank |
| CMX | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 538 | DrugCentral |
| Cefmenoxime | Wikipedia |
| CN101816660 | Patent |
| D01739 | KEGG DRUG |
| DB00267 | DrugBank |
| DE2713272 | Patent |
| US4476122 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5787828 | Reaxys |
| CAS:65085-01-0 | ChemIDplus |
| CAS:65085-01-0 | DrugBank |
| Citations |
|---|