EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15N7O5S4 |
| Net Charge | 0 |
| Average Mass | 513.608 |
| Monoisotopic Mass | 513.00175 |
| SMILES | [H][C@]12SCC(CSc3cnns3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C16H15N7O5S4/c1-28-21-9(7-5-31-16(17)19-7)12(24)20-10-13(25)23-11(15(26)27)6(4-30-14(10)23)3-29-8-2-18-22-32-8/h2,5,10,14H,3-4H2,1H3,(H2,17,19)(H,20,24)(H,26,27)/b21-9-/t10-,14-/m1/s1 |
| InChIKey | CXHKZHZLDMQGFF-ZSDSSEDPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefuzonam (CHEBI:55488) has role antibacterial drug (CHEBI:36047) |
| cefuzonam (CHEBI:55488) is a cephalosporin (CHEBI:23066) |
| cefuzonam (CHEBI:55488) is conjugate acid of cefuzonam(1−) (CHEBI:55494) |
| Incoming Relation(s) |
| cefuzonam(1−) (CHEBI:55494) is conjugate base of cefuzonam (CHEBI:55488) |
| IUPAC Names |
|---|
| (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-3-[(1,2,3-thiadiazol-5-ylsulfanyl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7β-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(1,2,3-thiadiazol-5-ylsulfanyl)methyl]-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefuzonam | ChemIDplus |
| cefuzonamum | ChemIDplus |
| Synonym | Source |
|---|---|
| cefuzoname | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6030288 | Reaxys |
| CAS:82219-78-1 | KEGG DRUG |
| CAS:82219-78-1 | ChemIDplus |
| Citations |
|---|