EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N6O10S2 |
| Net Charge | 0 |
| Average Mass | 466.410 |
| Monoisotopic Mass | 466.02128 |
| SMILES | NC(=O)OC[C@@H]1[C@H](NC(=O)/C(=N\OCC(=O)O)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C12H14N6O10S2/c13-11-15-4(3-29-11)7(17-28-2-6(19)20)9(21)16-8-5(1-27-12(14)23)18(10(8)22)30(24,25)26/h3,5,8H,1-2H2,(H2,13,15)(H2,14,23)(H,16,21)(H,19,20)(H,24,25,26)/b17-7-/t5-,8+/m1/s1 |
| InChIKey | UIMOJFJSJSIGLV-JNHMLNOCSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carumonam (CHEBI:55486) has role antibacterial drug (CHEBI:36047) |
| carumonam (CHEBI:55486) is a monobactam (CHEBI:50695) |
| carumonam (CHEBI:55486) is conjugate acid of carumonam(1−) (CHEBI:55492) |
| Incoming Relation(s) |
| carumonam(1−) (CHEBI:55492) is conjugate base of carumonam (CHEBI:55486) |
| IUPAC Name |
|---|
| ({[(1Z)-1-(2-amino-1,3-thiazol-4-yl)-2-({(2S,3S)-2-[(carbamoyloxy)methyl]-4-oxo-1-sulfoazetidin-3-yl}amino)-2-oxoethylidene]amino}oxy)acetic acid |
| INNs | Source |
|---|---|
| carumonam | ChemIDplus |
| carumonamum | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5786139 | Reaxys |
| CAS:87638-04-8 | ChemIDplus |
| Citations |
|---|