EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25N3O4 |
| Net Charge | 0 |
| Average Mass | 287.360 |
| Monoisotopic Mass | 287.18451 |
| SMILES | CCC(CN1CCOCC1)(CN1CCOCC1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H25N3O4/c1-2-13(16(17)18,11-14-3-7-19-8-4-14)12-15-5-9-20-10-6-15/h2-12H2,1H3 |
| InChIKey | XPGDDCOXMUFUCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-(ethyl-2-nitropropane-1,3-diyl)bismorpholine (CHEBI:55483) has role allergen (CHEBI:50904) |
| 4,4'-(ethyl-2-nitropropane-1,3-diyl)bismorpholine (CHEBI:55483) is a C-nitro compound (CHEBI:35716) |
| 4,4'-(ethyl-2-nitropropane-1,3-diyl)bismorpholine (CHEBI:55483) is a morpholines (CHEBI:38785) |
| IUPAC Name |
|---|
| 4-[2-(morpholin-4-ylmethyl)-2-nitrobutyl]morpholine |
| Synonyms | Source |
|---|---|
| 4,4'-(2-Ethyl-2-nitrotrimethylene)dimorpholine | ChemIDplus |
| 4,4'-(ethyl-2-nitro-1,3-propanediyl)-bis morpholine | ChEBI |
| 4,4'-(ethyl-2-nitro-1,3-propanediyl)bismorpholine | ChemIDplus |
| 4,4'-(ethyl-2-nitropropane-1,3-diyl)bismorpholine | ChEBI |
| Citations |
|---|