EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:55482 - 4-(2-nitrobutyl)morpholine
| Formula | C8H16N2O3 |
| Net Charge | 0 |
| Average Mass | 188.227 |
| Monoisotopic Mass | 188.11609 |
| SMILES | CCC(CN1CCOCC1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H16N2O3/c1-2-8(10(11)12)7-9-3-5-13-6-4-9/h8H,2-7H2,1H3 |
| InChIKey | GQHVWDKJTDUZRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2-nitrobutyl)morpholine (CHEBI:55482) has role allergen (CHEBI:50904) |
| 4-(2-nitrobutyl)morpholine (CHEBI:55482) has role antimicrobial agent (CHEBI:33281) |
| 4-(2-nitrobutyl)morpholine (CHEBI:55482) is a morpholines (CHEBI:38785) |
| IUPAC Name |
|---|
| 4-(2-nitrobutyl)morpholine |
| Synonyms | Source |
|---|---|
| N-(2-Nitrobutyl)morpholine | ChemIDplus |
| 4-(2-nitrobutyl)-morpholine | ChEBI |
| Citations |
|---|