EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | O=C(O)CNc1ccccc1 |
| InChI | InChI=1S/C8H9NO2/c10-8(11)6-9-7-4-2-1-3-5-7/h1-5,9H,6H2,(H,10,11) |
| InChIKey | NPKSPKHJBVJUKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-phenylglycine (CHEBI:55477) has role allergen (CHEBI:50904) |
| N-phenylglycine (CHEBI:55477) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| IUPAC Name |
|---|
| N-phenylglycine |
| Synonyms | Source |
|---|---|
| Anilinoacetic acid | NIST Chemistry WebBook |
| NPG | ChEBI |
| Citations |
|---|