EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O4 |
| Net Charge | 0 |
| Average Mass | 236.227 |
| Monoisotopic Mass | 236.07971 |
| SMILES | [H]C(=O)Nc1ccccc1C(=O)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C11H12N2O4/c12-8(11(16)17)5-10(15)7-3-1-2-4-9(7)13-6-14/h1-4,6,8H,5,12H2,(H,13,14)(H,16,17)/t8-/m1/s1 |
| InChIKey | BYHJHXPTQMMKCA-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formyl-D-kynurenine (CHEBI:55476) is a D-α-amino acid (CHEBI:16733) |
| N-formyl-D-kynurenine (CHEBI:55476) is a formamides (CHEBI:24079) |
| N-formyl-D-kynurenine (CHEBI:55476) is tautomer of N-formyl-D-kynurenine zwitterion (CHEBI:60051) |
| Incoming Relation(s) |
| N-formyl-D-kynurenine zwitterion (CHEBI:60051) is tautomer of N-formyl-D-kynurenine (CHEBI:55476) |
| IUPAC Name |
|---|
| (2R)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C15605 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11376784 | Beilstein |
| Reaxys:15806246 | Reaxys |